| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:38 UTC |
|---|
| Update Date | 2025-03-25 01:01:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02246284 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H21N |
|---|
| Molecular Mass | 215.1674 |
|---|
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(C)cc21 |
|---|
| InChI Key | IKVJURIOPDEVKH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | quinolones and derivatives |
|---|
| Direct Parent | hydroquinolones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsdialkylarylamineshydrocarbon derivativeshydroquinolinesorganopnictogen compounds |
|---|
| Substituents | azacycledihydroquinolinedihydroquinolonearomatic heteropolycyclic compoundtertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compounddialkylarylamineaminetertiary amine |
|---|
