| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:38 UTC |
|---|
| Update Date | 2025-03-25 01:01:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02246298 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9O8PS |
|---|
| Molecular Mass | 259.9756 |
|---|
| SMILES | CC1=CC(COP(=O)(O)O)OS(=O)(=O)O1 |
|---|
| InChI Key | ULDYXKBRDDGLJE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid diesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfateshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | oxacycleorganic oxideorganic oxygen compoundsulfuric acid diesterphosphoric acid estermonoalkyl phosphatealkyl sulfatealiphatic heteromonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compoundorganooxygen compound |
|---|
