| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:40 UTC |
|---|
| Update Date | 2025-03-25 01:01:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02246358 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H34O8 |
|---|
| Molecular Mass | 498.2254 |
|---|
| SMILES | CC1=C(CCC(=O)O)C(=Cc2cc(C)c(CCC(=O)O)c(C)c2CCC(=O)O)C(CCC(=O)O)=C1C |
|---|
| InChI Key | JWFOHESKYWFGOT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesorganic oxidesphenylpropanoic acidsm-xylenes |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidm-xylenetetracarboxylic acid or derivativesaromatic homomonocyclic compoundxyleneorganic oxideorganic oxygen compoundhydrocarbon derivativebenzenoidorganooxygen compound |
|---|