| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:47 UTC |
|---|
| Update Date | 2025-03-25 01:01:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02246632 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16O6 |
|---|
| Molecular Mass | 232.0947 |
|---|
| SMILES | CCC(O)(CC(=O)OC)CC(=O)OC(C)=O |
|---|
| InChI Key | IBKROBURRQKNBD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid anhydridesfatty acid methyl estershydrocarbon derivativesmethyl estersorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl grouptricarboxylic acid or derivativesfatty acid estertertiary alcoholorganic oxidefatty acid methyl estermethyl esterorganic oxygen compoundcarboxylic acid estercarboxylic acid anhydridehydrocarbon derivativeorganooxygen compound |
|---|
