| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:52 UTC |
|---|
| Update Date | 2025-03-25 01:01:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02246828 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H44N6O7S2 |
|---|
| Molecular Mass | 652.2713 |
|---|
| SMILES | CCC1C(Cc2[nH]c(Cc3[nH]c(CSCCC(N)=NS(N)(=O)=O)c(C)c3CCC(=O)O)c(CCC(=O)O)c2C)NC(=O)C1C |
|---|
| InChI Key | QUSYRTUFJLYFFG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | dicarboxylic acids and derivatives |
|---|
| Direct Parent | dicarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amidinesazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundspyrrolespyrrolidine-2-onessecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | 2-pyrrolidonecarbonyl grouplactamcarboxylic acidaromatic heteromonocyclic compoundamidineorganosulfur compoundorganic oxideorganonitrogen compoundorganopnictogen compoundpyrrolidinepyrrolidoneorganoheterocyclic compoundorganic sulfuric acid or derivativessulfenyl compoundazacycledialkylthioetherheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundthioetherpyrroledicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
