| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:59 UTC |
|---|
| Update Date | 2025-03-25 01:01:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247123 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C36H55N11O10S |
|---|
| Molecular Mass | 833.3854 |
|---|
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCSC)C(=O)O |
|---|
| InChI Key | LFYRRAOHNVKBMB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesaspartic acid and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acidsdialkylthioethersdicarboxylic acids and derivativesguanidinesheteroaromatic compoundshydrocarbon derivativeshydroxy fatty acidsimidazolesisoleucine and derivativesmethionine and derivativesmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundspeptidesphenylalanine and derivativespropargyl-type 1,3-dipolar organic compoundssecondary carboxylic acid amidessulfenyl compoundsthia fatty acidstyrosine and derivatives |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidalpha-amino acid or derivativesalpha peptideorganonitrogen compoundalpha-amino acidhydroxy fatty acidisoleucine or derivativesorganoheterocyclic compoundn-acyl-alpha amino acid or derivativespolypeptidetyrosine or derivativessulfenyl compoundalpha-amino acid amideazacyclen-acyl-alpha-amino aciddialkylthioetherheteroaromatic compoundorganic 1,3-dipolar compoundn-substituted-alpha-amino acidsecondary carboxylic acid amidethioethermethionine or derivativesaspartic acid or derivativesdicarboxylic acid or derivativesphenolhydrocarbon derivativeprimary aliphatic aminefatty acylcarbonyl grouparomatic heteromonocyclic compoundguanidinefatty amide1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundcarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxideimidazoleorganopnictogen compoundamphetamine or derivativesazolecarboximidamidecarboxamide groupn-acyl-aminethia fatty acidphenylalanine or derivativesorganic oxygen compoundbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|