| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:04 UTC |
|---|
| Update Date | 2025-03-25 01:01:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247298 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O3 |
|---|
| Molecular Mass | 264.1474 |
|---|
| SMILES | CNCCCC(=O)c1cc(OC)ccc1NC(C)=O |
|---|
| InChI Key | QGSJYKDGHNNGEI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesalkyl aryl ethersamino acids and derivativesanisolesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acids and derivativesdialkylamineshydrocarbon derivativesmethoxybenzenesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenoxy compoundsphenylbutylaminessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketonen-acetylarylamineamino acid or derivativesbenzoyln-arylamidealkyl aryl ethercarboxylic acid derivativeorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundacetamidevinylogous amidesecondary aliphatic amineacetanilidesecondary aminecarboxamide groupmethoxybenzenebutyrophenonearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundalkyl-phenylketoneamine |
|---|
