| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:06 UTC |
|---|
| Update Date | 2025-03-25 01:01:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247372 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17NO7 |
|---|
| Molecular Mass | 323.1005 |
|---|
| SMILES | O=C(O)CCC(NC(CC(=O)c1ccccc1)C(=O)O)C(=O)O |
|---|
| InChI Key | LEUIDCPAJFYZOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl-phenylketonesalpha amino acidsamino acidsaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acidsdialkylaminesgamma-keto acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundstricarboxylic acids and derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidaryl alkyl ketoneamino acidbenzoyltricarboxylic acid or derivativesketoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundsecondary aliphatic amineglutamic acid or derivativessecondary aminephenylketonegamma-keto acidbutyrophenonearomatic homomonocyclic compoundorganic oxygen compoundketo acidhydrocarbon derivativebenzenoidorganic nitrogen compoundalkyl-phenylketoneorganooxygen compoundaminearyl ketone |
|---|
