| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:06 UTC |
|---|
| Update Date | 2025-03-25 01:01:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247385 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H18O5 |
|---|
| Molecular Mass | 326.1154 |
|---|
| SMILES | O=C(O)CCC1c2ccccc2C(c2ccc(O)cc2)C1C(=O)O |
|---|
| InChI Key | GPKMXYBZZXFYHS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | indanes |
|---|
| Subclass | indanes |
|---|
| Direct Parent | indanes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundcarboxylic acid derivativeorganic oxideorganic oxygen compoundindanedicarboxylic acid or derivativesphenolhydrocarbon derivativeorganooxygen compound |
|---|