| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:08 UTC |
|---|
| Update Date | 2025-03-25 01:01:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247467 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H17NO2S |
|---|
| Molecular Mass | 323.098 |
|---|
| SMILES | C=CCS(=O)(=O)c1cccc2cccc(Nc3ccccc3)c12 |
|---|
| InChI Key | JEWRQCIDNHFRFA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | allyl sulfur compoundsbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundssecondary aminessulfones |
|---|
| Substituents | monocyclic benzene moietyallyl sulfur compoundaromatic homopolycyclic compoundsecondary amineorganosulfur compound1-naphthalene sulfonic acid or derivativesorganic oxidesulfonylorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminesulfone |
|---|
