| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:09 UTC |
|---|
| Update Date | 2025-03-25 01:01:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247475 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13NO5S |
|---|
| Molecular Mass | 259.0514 |
|---|
| SMILES | CC(Oc1ccc(CC(N)=O)cc1)S(=O)(=O)O |
|---|
| InChI Key | GZYBVMFIGPBHII-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acidsphenol ethersphenoxy compoundsprimary carboxylic acid amidessulfonyls |
|---|
| Substituents | primary carboxylic acid amidephenol etherorganosulfonic acid or derivativescarbonyl grouporganosulfonic acidorganosulfur compoundcarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundphenylacetamideorganooxygen compound |
|---|
