| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:13 UTC |
|---|
| Update Date | 2025-03-25 01:01:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247637 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H23N3O7 |
|---|
| Molecular Mass | 345.1536 |
|---|
| SMILES | CC(C)CC(NC(=O)CC(=O)NC(=O)CCC(N)C(=O)O)C(=O)O |
|---|
| InChI Key | OYNMPBPYDYFEPW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | hybrid peptides |
|---|
| Direct Parent | hybrid peptides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdicarboximidesdicarboxylic acids and derivativesglutamine and derivativeshydrocarbon derivativesleucine and derivativesmethyl-branched fatty acidsmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidglutamine or derivativesfatty acidalpha-amino acid or derivativescarboxylic acid derivativecarboxylic acid imide, n-unsubstitutedorganic oxideleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximiden-acyl-alpha amino acid or derivativesmethyl-branched fatty acidn-acyl-alpha-amino acidcarboxamide groupbranched fatty acidn-acyl-aminecarboxylic acid imidesecondary carboxylic acid amideorganic oxygen compounddicarboxylic acid or derivativeshybrid peptidehydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
