| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:14 UTC |
|---|
| Update Date | 2025-03-25 01:01:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247655 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H30O20S |
|---|
| Molecular Mass | 598.1051 |
|---|
| SMILES | O=C(O)C1OC(OC2C(CO)OC(O)C(O)C2OS(=O)(=O)O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | BMKMYLMYHFVOKY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides of mono- and disaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl sulfatescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidesulfuric acid monoestercarbonyl groupcarboxylic acidglucuronic acid or derivativeso-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidesaccharideorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesorganic sulfuric acid or derivativesoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|