| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:14 UTC |
|---|
| Update Date | 2025-03-25 01:01:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247675 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H17N3O2 |
|---|
| Molecular Mass | 295.1321 |
|---|
| SMILES | COc1ccc(C2(c3ccccc3)N=C(N)N(C)C2=O)cc1 |
|---|
| InChI Key | VJOYOUKJSHACSN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha amino acidsanisolesazacyclic compoundscarbonyl compoundscarboximidamidescarboxylic acids and derivativesguanidineshydrocarbon derivativesimidazolinonesmethoxybenzenesorganic oxidesorganopnictogen compoundsphenoxy compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | diphenylmethanephenol ethercarbonyl groupetheraromatic heteromonocyclic compoundguanidinealpha-amino acid or derivativesalkyl aryl ethercarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundimidazolinoneorganoheterocyclic compoundazacycleorganic 1,3-dipolar compoundcarboximidamidemethoxybenzeneorganic oxygen compound2-imidazolineanisoleimidazolinehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|