| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:15 UTC |
|---|
| Update Date | 2025-03-25 01:01:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247706 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14Cl2O4 |
|---|
| Molecular Mass | 292.0269 |
|---|
| SMILES | OC1CCC(Oc2ccc(Cl)c(Cl)c2)C(O)C1O |
|---|
| InChI Key | XHVPSDKJXKBFOE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | dichlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl chloridescyclitols and derivativescyclohexanolshydrocarbon derivativesorganochloridesphenol ethersphenoxy compounds |
|---|
| Substituents | aryl chloridealcoholphenol etheretherorganochloridecyclohexanolcyclitol or derivativescyclic alcoholalkyl aryl etherorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholhydrocarbon derivative1,2-dichlorobenzenephenoxy compoundorganooxygen compound |
|---|
