| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:16 UTC |
|---|
| Update Date | 2025-03-25 01:01:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247726 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10NO8P |
|---|
| Molecular Mass | 255.0144 |
|---|
| SMILES | O=C1NC(C(O)CO)C(O)=C1OP(=O)(O)O |
|---|
| InChI Key | IXKJZBIOOSPMBX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphate esters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspyrrolinessecondary alcoholssecondary carboxylic acid amidesvinylogous acids |
|---|
| Substituents | alcoholcarbonyl grouplactamazacyclecarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amidevinylogous acidorganic oxideorganic oxygen compoundpyrrolinephosphoric acid esteraliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|
