| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:21 UTC |
|---|
| Update Date | 2025-03-25 01:01:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02247928 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14N4O3 |
|---|
| Molecular Mass | 202.1066 |
|---|
| SMILES | NC1=NCC(C(O)C(N)CC(=O)O)N1 |
|---|
| InChI Key | KSXHUBBQXRORGC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbeta amino acids and derivativescarbonyl compoundscarboximidamidescarboxylic acidsguanidinesheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsimidazolinesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssecondary alcoholsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidshort-chain hydroxy acidheterocyclic fatty acidguanidinefatty acidpropargyl-type 1,3-dipolar organic compoundorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddelta amino acid or derivativeshydroxy fatty acidorganoheterocyclic compoundalcoholazacycleorganic 1,3-dipolar compoundcarboximidamidebeta amino acid or derivativesmonocarboxylic acid or derivativesorganic oxygen compound2-imidazolineimidazolinesecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
