| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:26 UTC |
|---|
| Update Date | 2025-03-25 01:01:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248109 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H16N2O12P2 |
|---|
| Molecular Mass | 382.0178 |
|---|
| SMILES | NC(=O)NC1OC(COP(=O)(O)OP(=O)(O)O)C(O)C(O)C1O |
|---|
| InChI Key | LAMJUXIHTQPTSC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarbonic acid derivativeorganic pyrophosphateoxacycleorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholhexose phosphateorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundoxaneorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compound |
|---|
