| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:26 UTC |
|---|
| Update Date | 2025-03-25 01:01:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248128 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21N3O |
|---|
| Molecular Mass | 295.1685 |
|---|
| SMILES | NC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChI Key | WXDRNUXKGWEPCG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aralkylaminesazacyclic compoundscarbonyl compoundshydrocarbon derivativesn-alkylpiperazinesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundspiperazine carboxamidestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacyclen-alkylpiperazinetertiary aliphatic aminearalkylaminepiperazine-1-carboxamideorganic oxideorganic oxygen compoundpiperazine1,4-diazinaneorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminetertiary amineorganoheterocyclic compoundorganooxygen compound |
|---|
