| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:27 UTC |
|---|
| Update Date | 2025-03-25 01:01:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248142 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NOS2 |
|---|
| Molecular Mass | 281.0908 |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)CCC1CCSS1 |
|---|
| InChI Key | YKUQZFFDWRMRDL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-dithiolanescarbonyl compoundscarboxylic acids and derivativesfatty amideshydrocarbon derivativesn-arylamidesorganic disulfidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidesm-xylenes |
|---|
| Substituents | fatty acylcarbonyl grouparomatic heteromonocyclic compoundfatty amiden-arylamidecarboxylic acid derivative1,2-dithiolanexyleneorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundm-xylenecarboxamide groupanilidesecondary carboxylic acid amideorganic oxygen compounddithiolaneorganic disulfidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|