DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 15:20:29 UTC
Update Date	2025-03-25 01:01:17 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02248208
Frequency	0.5
Structure
Chemical Formula	C₁₉H₃₀N₆O₁₅P₂
Molecular Mass	644.1244
SMILES	NC(=O)C1CC=CN(C2OC(COP(=O)(O)OP(=O)(O)OCC3OC(n4ccc(N)nc4=O)C(O)C3O)C(O)C2O)N1
InChI Key	MWGQUWPWUHKYEZ-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	nucleosides, nucleotides, and analogues
Class	pyrimidine nucleotides
Subclass	pyrimidine ribonucleotides
Direct Parent	pyrimidine ribonucleoside diphosphates
Geometric Descriptor	aromatic heteromonocyclic compounds
Alternative Parents	alkylhydrazines alpha amino acids azacyclic compounds carbonyl compounds carboxylic acids and derivatives heteroaromatic compounds hydrocarbon derivatives imidolactams monoalkyl phosphates monosaccharides organic carbonic acids and derivatives organic oxides organic pyrophosphates organopnictogen compounds oxacyclic compounds pentose phosphates primary amines primary carboxylic acid amides pyrimidones secondary alcohols tetrahydrofurans
Substituents	primary carboxylic acid amide carbonyl group aromatic heteromonocyclic compound pentose phosphate amino acid or derivatives monosaccharide pentose-5-phosphate pyrimidone alpha-amino acid or derivatives carboxylic acid derivative pyrimidine alkylhydrazine saccharide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound imidolactam organoheterocyclic compound alcohol carbonic acid derivative hydrazine derivative azacycle tetrahydrofuran heteroaromatic compound carboxamide group organic pyrophosphate oxacycle pyrimidine ribonucleoside diphosphate organic oxygen compound phosphoric acid ester monoalkyl phosphate secondary alcohol hydrocarbon derivative primary amine organic nitrogen compound organic phosphoric acid derivative amine alkyl phosphate organooxygen compound

Showing information for DMID02248208