| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:30 UTC |
|---|
| Update Date | 2025-03-25 01:01:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248256 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H23N3O |
|---|
| Molecular Mass | 309.1841 |
|---|
| SMILES | Cc1ccccc1C(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
|---|
| InChI Key | HEJBTXZVVHQAAN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | benzanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaniline and substituted anilinesazacyclic compoundsbenzamidesbenzoyl derivativescarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesn-arylpiperazinesn-methylpiperazinesorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenylpiperazinessecondary carboxylic acid amidestrialkylamineso-toluamides |
|---|
| Substituents | benzanilidearomatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativetoluamidebenzamideorganic oxideo-toluamidepiperazinetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineorganoheterocyclic compoundazacycleaniline or substituted anilinesn-alkylpiperazinetertiary aliphatic aminen-methylpiperazinebenzoic acid or derivativescarboxamide groupphenylpiperazinesecondary carboxylic acid amideorganic oxygen compound1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundtolueneaminen-arylpiperazineorganooxygen compound |
|---|
