| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:35 UTC |
|---|
| Update Date | 2025-03-25 01:01:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248438 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12N6O |
|---|
| Molecular Mass | 268.1073 |
|---|
| SMILES | Cn1cnc2nc(N)nc(Nc3ccccc3)c2c1=O |
|---|
| InChI Key | YOYDFSVNTIXALQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminessecondary aminesvinylogous amides |
|---|
| Substituents | vinylogous amidemonocyclic benzene moietylactamazacycleheteroaromatic compoundpyrimidonesecondary amineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound |
|---|
