| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:36 UTC |
|---|
| Update Date | 2025-03-25 01:01:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248468 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H21N3O |
|---|
| Molecular Mass | 247.1685 |
|---|
| SMILES | N=C(C(N)Cc1ccc(O)cc1)N1CCCCC1 |
|---|
| InChI Key | LKKVDFISCOVRIY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamidinesazacyclic compoundsbenzene and substituted derivativescarboximidamideshydrocarbon derivativesmonoalkylaminesorganooxygen compoundsorganopnictogen compoundspiperidines |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycle1-hydroxy-2-unsubstituted benzenoidamidinecarboximidamideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundpiperidineorganoheterocyclic compoundorganooxygen compoundamphetamine or derivatives |
|---|
