| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:36 UTC |
|---|
| Update Date | 2025-03-25 01:01:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248487 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H7N3O5S |
|---|
| Molecular Mass | 221.0106 |
|---|
| SMILES | Cn1c(N)cc(OS(=O)(=O)O)nc1=O |
|---|
| InChI Key | PWMFZLQYCMAKNB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrimidonessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonic acid derivativearomatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfateprimary amineorganic nitrogen compoundsulfuric acid esteramineorganoheterocyclic compoundorganooxygen compound |
|---|
