| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:41 UTC |
|---|
| Update Date | 2025-03-25 01:01:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248655 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H6Cl3N |
|---|
| Molecular Mass | 244.9566 |
|---|
| SMILES | ClC(Cl)(Cl)c1ccnc2ccccc12 |
|---|
| InChI Key | XRLDNCNKWYPWAX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | haloquinolines |
|---|
| Direct Parent | chloroquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl chloridesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesorganochloridesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyridines and derivativesquinolines and derivatives |
|---|
| Substituents | azacyclepolyhalopyridinealkyl chlorideorganochlorideheteroaromatic compoundorganohalogen compoundpyridinechloroquinolinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivativebenzenoid2-halopyridineorganic nitrogen compound |
|---|
