| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:45 UTC |
|---|
| Update Date | 2025-03-25 01:01:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248803 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H30N2O3 |
|---|
| Molecular Mass | 370.2256 |
|---|
| SMILES | COc1ccc(C(c2ccccc2)N2CCN(CCOCCO)CC2)cc1 |
|---|
| InChI Key | XWQLQAYIYCSVJU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl aryl ethersanisolesaralkylaminesazacyclic compoundsdialkyl ethershydrocarbon derivativesmethoxybenzenesn-alkylpiperazinesorganopnictogen compoundsphenoxy compoundstrialkylamines |
|---|
| Substituents | diphenylmethanephenol etheretheraromatic heteromonocyclic compoundalkyl aryl etherdialkyl etheraralkylaminepiperazineorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundalcoholazacyclen-alkylpiperazinetertiary aliphatic aminemethoxybenzeneorganic oxygen compoundanisole1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
