| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:46 UTC |
|---|
| Update Date | 2025-03-25 01:01:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248866 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O6 |
|---|
| Molecular Mass | 316.0947 |
|---|
| SMILES | COc1cc2c(cc1OC)C(O)C(O)c1cc3c(cc1-2)OCO3 |
|---|
| InChI Key | UYCGKTNXKPKGNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetalsalkyl aryl ethersanisolesbenzodioxoleshydrocarbon derivativesnaphthalenesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholphenol etherphenanthreneetheralkyl aryl etheroxacyclenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundanisolesecondary alcoholhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compoundbenzodioxole1,2-diol |
|---|
