| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:49 UTC |
|---|
| Update Date | 2025-03-25 01:01:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02248959 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18N2O |
|---|
| Molecular Mass | 266.1419 |
|---|
| SMILES | COc1ccc2[nH]cc(CCNc3ccccc3)c2c1 |
|---|
| InChI Key | XBXLGIJKJXTPLA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganopnictogen compoundsphenylalkylaminespyrrolessecondary alkylarylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherazacycleindoleheteroaromatic compoundalkyl aryl ethersecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundaromatic heteropolycyclic compoundanisolepyrroleorganonitrogen compoundorganopnictogen compoundphenylalkylaminehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
