| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:51 UTC |
|---|
| Update Date | 2025-03-25 01:01:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249041 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H24O3 |
|---|
| Molecular Mass | 312.1725 |
|---|
| SMILES | COc1ccc(C=CC(=O)C2=C(C)C=CCC2(C)C)cc1OC |
|---|
| InChI Key | NLBDCGASZNKFBO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha,beta-unsaturated ketonesanisolesdimethoxybenzeneshydrocarbon derivativesketonesorganic oxidesphenoxy compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheralkyl aryl etheralpha,beta-unsaturated ketonemethoxybenzeneketonearomatic homomonocyclic compounddimethoxybenzenecinnamic acid or derivativesorganic oxideorganic oxygen compoundanisoleo-dimethoxybenzenehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
