| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:58 UTC |
|---|
| Update Date | 2025-03-25 01:01:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249307 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H26N3O13P |
|---|
| Molecular Mass | 499.1203 |
|---|
| SMILES | COC1C(OP(=O)(O)OCC2OC(n3ccc(N)nc3=O)C(O)C2O)OC(CO)C(O)C1O |
|---|
| InChI Key | PYSPRRCLFGINEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleotides |
|---|
| Subclass | pyrimidine ribonucleotides |
|---|
| Direct Parent | pyrimidine ribonucleoside monophosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersdialkyl phosphatesheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary alcoholsprimary aminespyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | etheraromatic heteromonocyclic compoundpentose phosphatemonosaccharidepentose-5-phosphatepyrimidonedialkyl etherpyrimidinesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycledialkyl phosphatepyrimidine ribonucleoside monophosphateorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|