| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:20:58 UTC |
|---|
| Update Date | 2025-03-25 01:01:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249333 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H36O10 |
|---|
| Molecular Mass | 508.2308 |
|---|
| SMILES | COc1cc(CC(CO)C(COC2CC(O)C(O)C(O)C2O)Cc2ccc(O)c(OC)c2)ccc1O |
|---|
| InChI Key | AHIXYMHGYNIYHI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | dibenzylbutane lignans |
|---|
| Subclass | dibenzylbutane lignans |
|---|
| Direct Parent | dibenzylbutane lignans |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolescyclitols and derivativescyclohexanolsdialkyl ethershydrocarbon derivativesmethoxybenzenesmethoxyphenolsphenoxy compoundsprimary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherdialkyl etherdibenzylbutane lignan skeletonprimary alcoholalcoholcyclohexanolcyclitol or derivativescyclic alcoholmethoxybenzenearomatic homomonocyclic compoundorganic oxygen compoundanisolesecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|