| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:00 UTC |
|---|
| Update Date | 2025-03-25 01:01:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249374 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H13Br2NO3 |
|---|
| Molecular Mass | 412.9262 |
|---|
| SMILES | COc1cc(NC(C)=O)ccc1Oc1ccc(Br)cc1Br |
|---|
| InChI Key | YDUXOSOYFLMMEX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | bromodiphenyl ethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesalkyl aryl ethersanisolesaryl bromidesbromobenzenescarbonyl compoundscarboxylic acids and derivativesdiarylethershydrocarbon derivativesmethoxybenzenesn-acetylarylaminesorganic oxidesorganobromidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethern-acetylarylaminebromodiphenyl ethern-arylamidealkyl aryl ethercarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideacetanilidebromobenzenecarboxamide groupmethoxybenzenearyl halidearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundanisoleorganobromidehydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compoundaryl bromideorganooxygen compound |
|---|
