| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:02 UTC |
|---|
| Update Date | 2025-03-25 01:01:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249459 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14N2O3 |
|---|
| Molecular Mass | 270.1004 |
|---|
| SMILES | COc1cc(C=CNC(=O)c2cccnc2)ccc1O |
|---|
| InChI Key | QCJZKYFXWZCOTR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | methoxyphenols |
|---|
| Direct Parent | methoxyphenols |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethoxybenzenesmethylpyridinesnicotinamidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundspyridinecarboxylic acids and derivativessecondary carboxylic acid amides |
|---|
| Substituents | pyridine carboxylic acid or derivativesphenol ethermonocyclic benzene moietyetheraromatic heteromonocyclic compoundnicotinamide1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl ethercarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazacycleheteroaromatic compoundhydroxypyridinemethylpyridinecarboxamide groupmethoxybenzenesecondary carboxylic acid amidepyridineorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
