| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:05 UTC |
|---|
| Update Date | 2025-03-25 01:01:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249581 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10N2O4 |
|---|
| Molecular Mass | 258.0641 |
|---|
| SMILES | Cc1c(-c2ccc(O)cc2)oc2[nH]c(=O)[nH]c(=O)c12 |
|---|
| InChI Key | SKDCSZVDXAQRRD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furo[2,3-d]pyrimidines |
|---|
| Subclass | furo[2,3-d]pyrimidines |
|---|
| Direct Parent | furo[2,3-d]pyrimidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesfuransheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidonesvinylogous amides |
|---|
| Substituents | furo[2,3-d]pyrimidinefuranvinylogous amidemonocyclic benzene moietycarbonic acid derivativelactamazacycleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidpyrimidonepyrimidineoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|