| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:05 UTC |
|---|
| Update Date | 2025-03-25 01:01:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249602 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13N2O+ |
|---|
| Molecular Mass | 153.1022 |
|---|
| SMILES | C[N+]1(C)C=CCC(C(N)=O)=C1 |
|---|
| InChI Key | VSFRQLKFMLCSNI-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | n-substituted nicotinamides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdihydropyridineshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsprimary carboxylic acid amidesquaternary ammonium salts |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupazacyclequaternary ammonium saltcarboxamide groupcarboxylic acid derivativen-substituted nicotinamideorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationdihydropyridineorganic saltamineorganooxygen compound |
|---|