| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:06 UTC |
|---|
| Update Date | 2025-03-25 01:01:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249630 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H28O5 |
|---|
| Molecular Mass | 348.1937 |
|---|
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C1CCC(O)(C(=O)O)CC1)O2 |
|---|
| InChI Key | FFAAOBHUXNWQHU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzopyrans |
|---|
| Subclass | 1-benzopyrans |
|---|
| Direct Parent | 1-benzopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha hydroxy acids and derivativesbenzenoidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativescyclohexanolshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupethercarboxylic acid1-benzopyranalpha-hydroxy acidcyclohexanolhydroxy acidcyclic alcoholalkyl aryl ethercarboxylic acid derivativeoxacycletertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
