| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:07 UTC |
|---|
| Update Date | 2025-03-25 01:01:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249659 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H9NOS2 |
|---|
| Molecular Mass | 235.0126 |
|---|
| SMILES | Cc1ccc(C=C2SC(=S)NC2=O)cc1 |
|---|
| InChI Key | RAXPMQHOSGNELK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | toluenes |
|---|
| Direct Parent | toluenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativescyclic dithiocarbamic acid estershydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfur compoundsthiazolidinethiones |
|---|
| Substituents | cyclic dithiocarbamic acid esterthiazolidinethionecarbonyl grouparomatic heteromonocyclic compoundazacycleorganosulfur compoundcarboxylic acid derivativedithiocarbamic acid esterorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundtolueneorganoheterocyclic compoundorganooxygen compoundthiazolidine |
|---|