| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:08 UTC |
|---|
| Update Date | 2025-03-25 01:01:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249706 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O7S2 |
|---|
| Molecular Mass | 269.9868 |
|---|
| SMILES | Cc1ccc(O[SH](=O)(O)OS(=O)(=O)O)cc1 |
|---|
| InChI Key | KQPOIFVVRNNZKV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxy compounds |
|---|
| Direct Parent | phenoxy compounds |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganooxygen compoundstoluenes |
|---|
| Substituents | aromatic homomonocyclic compoundorganic oxideorganic sulfuric acid or derivativesorganic oxygen compoundhydrocarbon derivativephenoxy compoundtolueneorganooxygen compound |
|---|
