| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:10 UTC |
|---|
| Update Date | 2025-03-25 01:01:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249771 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10O4 |
|---|
| Molecular Mass | 194.0579 |
|---|
| SMILES | Cc1cc(O)c(O)c2c1OC(=O)CC2 |
|---|
| InChI Key | JVBXJUYPQKWJLR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | 3,4-dihydrocoumarins |
|---|
| Subclass | 3,4-dihydrocoumarins |
|---|
| Direct Parent | 3,4-dihydrocoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsbenzenoidscarbonyl compoundscarboxylic acid estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | carbonyl groupbenzopyran1-benzopyran3,4-dihydrocoumarin1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundcarboxylic acid esterchromanehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|