| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:10 UTC |
|---|
| Update Date | 2025-03-25 01:01:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249778 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6Cl2O3 |
|---|
| Molecular Mass | 219.9694 |
|---|
| SMILES | Cc1cc(Cl)c(C(=O)O)c(Cl)c1O |
|---|
| InChI Key | DYJPEWSSJSCWGU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | dichlorobenzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds2-halobenzoic acidsaryl chloridesbenzoyl derivativesdichlorobenzeneshalobenzoic acidshalophenolshydrocarbon derivativeshydroxybenzoic acid derivativesmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochloridesorganooxygen compoundsortho cresolsp-chlorophenolstoluenesvinylogous halides |
|---|
| Substituents | 2-halobenzoic acidcarboxylic acidorganochloridebenzoylcarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzeneorganic oxide4-halophenol2,6-dichlorobenzoic acido-cresol1-carboxy-2-haloaromatic compoundaryl chloride2-chlorophenolchlorobenzenehalobenzoic acid4-chlorophenolhalobenzoic acid or derivativesvinylogous halide2-halobenzoic acid or derivativesaryl halidehydroxybenzoic acidaromatic homomonocyclic compound2-halophenolmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativehalobenzenetolueneorganooxygen compound |
|---|
