| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:11 UTC |
|---|
| Update Date | 2025-03-25 01:01:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249799 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H27N4O12P |
|---|
| Molecular Mass | 558.1363 |
|---|
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)C(O)COP(=O)(O)OCCC(O)C(=O)O)c2cc1C |
|---|
| InChI Key | WAMNFFJPSJKRTF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | flavin nucleotides |
|---|
| Subclass | flavin nucleotides |
|---|
| Direct Parent | flavin nucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidsdialkyl phosphatesdiazanaphthalenesflavinsheteroaromatic compoundshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrazinespyrimidonesquinoxalinessecondary alcohols |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidalpha-hydroxy acidmonosaccharidepyrimidonepteridinecarboxylic acid derivativeisoalloxazineflavinpyrimidinesaccharideorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundalcoholquinoxalinecarbonic acid derivativeazacycleflavin nucleotideheteroaromatic compoundhydroxy aciddialkyl phosphatemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterpyrazinesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
