| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:12 UTC |
|---|
| Update Date | 2025-03-25 01:01:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249847 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO2S |
|---|
| Molecular Mass | 273.0824 |
|---|
| SMILES | COc1ccccc1NC(=O)c1ccccc1SC |
|---|
| InChI Key | XEFNDXZNWILIQW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | benzanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalkylarylthioethersanisolesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzeneso-sulfanylbenzoic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidessulfenyl compoundsthiophenol ethersthiophenolsvinylogous thioesters |
|---|
| Substituents | phenol etheretherbenzanilidebenzoylalkyl aryl etheralkylarylthioetherorganosulfur compoundcarboxylic acid derivativebenzamidearyl thioetherorganic oxidethiophenolthiophenol etherorganonitrogen compoundorganopnictogen compoundvinylogous thioestersulfenyl compoundbenzoic acid or derivativescarboxamide groupmethoxybenzeneo-sulfanylbenzoic acid or derivativesaromatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundthioetheranisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|