| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:12 UTC |
|---|
| Update Date | 2025-03-25 01:01:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249866 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7N5O3 |
|---|
| Molecular Mass | 209.0549 |
|---|
| SMILES | COc1nc2nc(N)[nH]c(=O)c2nc1O |
|---|
| InChI Key | XZTBFRLJQYPPFK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmethoxypyrazinesorganic oxidesorganopnictogen compoundsprimary aminespyrimidones |
|---|
| Substituents | etherpterinlactamazacycleheteroaromatic compoundpyrimidonealkyl aryl etherpyrimidinemethoxypyrazineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
