| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:14 UTC |
|---|
| Update Date | 2025-03-25 01:01:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249921 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H8O6S2 |
|---|
| Molecular Mass | 227.9762 |
|---|
| SMILES | CSC(=O)CCC(=O)OS(=O)(=O)O |
|---|
| InChI Key | GZNTZTUBKXDACW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl thioesters |
|---|
| Direct Parent | fatty acyl thioesters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarbothioic s-estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessulfenyl compoundssulfuric acid monoestersthioestersthiolactones |
|---|
| Substituents | aliphatic acyclic compoundthiocarboxylic acid or derivativessulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativessulfenyl compoundthiocarboxylic acid esterorganosulfur compoundcarboxylic acid derivativecarbothioic s-esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativesulfuric acid esterfatty acyl thioesterthiolactoneorganooxygen compound |
|---|
