| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:14 UTC |
|---|
| Update Date | 2025-03-25 01:01:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02249923 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12O5 |
|---|
| Molecular Mass | 236.0685 |
|---|
| SMILES | COc1ccc2cc(C(O)CO)c(=O)oc2c1 |
|---|
| InChI Key | ONWINYGPXQXNJA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-benzopyransalkyl aryl ethersanisolesaromatic alcoholsheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundsprimary alcoholspyranones and derivativessecondary alcohols |
|---|
| Substituents | aromatic alcoholphenol etherether1-benzopyranalkyl aryl etherlactoneorganic oxidearomatic heteropolycyclic compoundpyranoneprimary alcoholorganoheterocyclic compound1,2-diolalcoholbenzopyranheteroaromatic compoundcoumarinoxacycleorganic oxygen compoundpyrananisolesecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|