| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:16 UTC |
|---|
| Update Date | 2025-03-25 01:01:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250014 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H16NO4+ |
|---|
| Molecular Mass | 178.1074 |
|---|
| SMILES | C[N+](C)(C)C(O)C(CO)C(=O)O |
|---|
| InChI Key | FOGHRQIETBUXMW-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshemiaminalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganonitrogen compoundsorganopnictogen compoundsprimary alcoholstetraalkylammonium salts |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidtetraalkylammonium saltcarboxylic acid derivativehemiaminalbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltprimary alcoholorganooxygen compoundalkanolamine |
|---|