| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:17 UTC |
|---|
| Update Date | 2025-03-25 01:01:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250025 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11NOS |
|---|
| Molecular Mass | 205.0561 |
|---|
| SMILES | CSc1c(C)c(=O)[nH]c2ccccc12 |
|---|
| InChI Key | VKAXAXPSIGCEBI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | quinolones and derivatives |
|---|
| Direct Parent | hydroquinolones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkylarylthioethersazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativeshydroquinolineslactamsmethylpyridinesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinespyridinonessulfenyl compoundsvinylogous thioesters |
|---|
| Substituents | lactampolyhalopyridinealkylarylthioetherorganosulfur compoundaryl thioetherorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridinevinylogous thioestersulfenyl compoundazacycleheteroaromatic compounddihydroquinolinemethylpyridinedihydroquinolonepyridineorganic oxygen compoundthioetherhydrocarbon derivativebenzenoidorganic nitrogen compoundpyridinoneorganooxygen compound |
|---|
