| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:18 UTC |
|---|
| Update Date | 2025-03-25 01:01:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250067 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22NO2+ |
|---|
| Molecular Mass | 224.1645 |
|---|
| SMILES | C[N+](C)(C)CCOc1ccc(CCO)cc1 |
|---|
| InChI Key | DRTIVQKYKNVRFI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl aryl ethersamineshydrocarbon derivativesorganic cationsorganic saltsorganopnictogen compoundsphenol ethersphenoxy compoundstetraalkylammonium salts |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietyethertetraalkylammonium saltquaternary ammonium saltalkyl aryl etheraromatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativetyrosol derivativeorganic nitrogen compoundorganic cationphenoxy compoundorganic saltamineorganooxygen compound |
|---|