| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:21:18 UTC |
|---|
| Update Date | 2025-03-25 01:01:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02250069 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H26NO14+ |
|---|
| Molecular Mass | 456.1348 |
|---|
| SMILES | C[N+](C)(CC(=O)OC1OC(C(=O)O)C(O)C(O)C1O)C1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | MZCNFQSHHGJOSB-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha amino acid estersalpha amino acidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsglucuronic acid derivativeshemiaminalshydrocarbon derivativesmonosaccharidesn-glucuronidesorganic cationsorganic oxidesorganic saltsorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstetraalkylammonium saltstricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acido-glucuronidemonosaccharidetricarboxylic acid or derivativesalpha-amino acid or derivativescarboxylic acid derivativepyran carboxylic acidn-glucuronidehemiaminal1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganic cationoxaneorganic saltorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativestetraalkylammonium saltalpha-amino acid esterhydroxy acidoxacyclepyrancarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|